C12H19N — CID 167623930
4,8-dimethyldeca-3,7-dienenitrile (PubChem CID 167623930) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 4,8-dimethyldeca-3,7-dienenitrile.
| Compound Name | 4,8-dimethyldeca-3,7-dienenitrile |
|---|---|
| PubChem CID | 167623930 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 4,8-dimethyldeca-3,7-dienenitrile |
| SMILES | CCC(C)=CCCC(C)=CCC#N |
| InChI | InChI=1S/C12H19N/c1-4-11(2)7-5-8-12(3)9-6-10-13/h7,9H,4-6,8H2,1-3H3 |
| InChIKey | MVAWJJNDLIPHHB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|