C17H29BrO4 — CID 101189632
[(E)-5-[(2R,3R)-3-[(3R)-3-bromo-4-hydroxy-4-methylpentyl]-3-methyloxiran-2-yl]-3-methylpent-2-enyl] acetate (PubChem CID 101189632) has the molecular formula C17H29BrO4 and a molecular weight of 377.32 g/mol. Its IUPAC name is [(E)-5-[(2R,3R)-3-[(3R)-3-bromo-4-hydroxy-4-methylpentyl]-3-methyloxiran-2-yl]-3-methylpent-2-enyl] acetate.
| Compound Name | [(E)-5-[(2R,3R)-3-[(3R)-3-bromo-4-hydroxy-4-methylpentyl]-3-methyloxiran-2-yl]-3-methylpent-2-enyl] acetate |
|---|---|
| PubChem CID | 101189632 |
| Molecular Formula | C17H29BrO4 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | [(E)-5-[(2R,3R)-3-[(3R)-3-bromo-4-hydroxy-4-methylpentyl]-3-methyloxiran-2-yl]-3-methylpent-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CC[C@H]1O[C@]1(C)CC[C@@H](Br)C(C)(C)O |
| InChI | InChI=1S/C17H29BrO4/c1-12(9-11-21-13(2)19)6-7-15-17(5,22-15)10-8-14(18)16(3,4)20/h9,14-15,20H,6-8,10-11H2,1-5H3/b12-9+/t14-,15-,17-/m1/s1 |
| InChIKey | PGQOWWMLDLDIMS-ZCWNTULYSA-N |
| XLogP | 3.75 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|