C12H21NO2 — CID 118210858
[5-(3,3-dimethylaziridin-2-yl)-3-methylpent-2-enyl] acetate (PubChem CID 118210858) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is [5-(3,3-dimethylaziridin-2-yl)-3-methylpent-2-enyl] acetate.
| Compound Name | [5-(3,3-dimethylaziridin-2-yl)-3-methylpent-2-enyl] acetate |
|---|---|
| PubChem CID | 118210858 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | [5-(3,3-dimethylaziridin-2-yl)-3-methylpent-2-enyl] acetate |
| SMILES | CC(=O)OCC=C(C)CCC1NC1(C)C |
| InChI | InChI=1S/C12H21NO2/c1-9(7-8-15-10(2)14)5-6-11-12(3,4)13-11/h7,11,13H,5-6,8H2,1-4H3 |
| InChIKey | CQDDPUCJKMDJFL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|