C11H13NO2 — CID 102008054
(3S,4R)-3-hydroxy-1,4-dimethyl-3-phenylazetidin-2-one (PubChem CID 102008054) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is (3S,4R)-3-hydroxy-1,4-dimethyl-3-phenylazetidin-2-one.
| Compound Name | (3S,4R)-3-hydroxy-1,4-dimethyl-3-phenylazetidin-2-one |
|---|---|
| PubChem CID | 102008054 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (3S,4R)-3-hydroxy-1,4-dimethyl-3-phenylazetidin-2-one |
| SMILES | C[C@H]1N(C)C(=O)[C@]1(O)c1ccccc1 |
| InChI | InChI=1S/C11H13NO2/c1-8-11(14,10(13)12(8)2)9-6-4-3-5-7-9/h3-8,14H,1-2H3/t8-,11-/m1/s1 |
| InChIKey | FENPYEPNHDCZCH-LDYMZIIASA-N |
| XLogP | 0.73 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |