C11H13N3O2 — CID 118537970
4-(hydroxyamino)-2,5-dimethyl-4-phenylpyrazol-3-one (PubChem CID 118537970) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 4-(hydroxyamino)-2,5-dimethyl-4-phenylpyrazol-3-one.
| Compound Name | 4-(hydroxyamino)-2,5-dimethyl-4-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 118537970 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 4-(hydroxyamino)-2,5-dimethyl-4-phenylpyrazol-3-one |
| SMILES | CC1=NN(C)C(=O)C1(NO)c1ccccc1 |
| InChI | InChI=1S/C11H13N3O2/c1-8-11(13-16,10(15)14(2)12-8)9-6-4-3-5-7-9/h3-7,13,16H,1-2H3 |
| InChIKey | QQRNZZDOMYCNDL-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|