C16H13BrN2O — CID 118538432
4-bromo-2-methyl-4,5-diphenylpyrazol-3-one (PubChem CID 118538432) has the molecular formula C16H13BrN2O and a molecular weight of 329.20 g/mol. Its IUPAC name is 4-bromo-2-methyl-4,5-diphenylpyrazol-3-one.
| Compound Name | 4-bromo-2-methyl-4,5-diphenylpyrazol-3-one |
|---|---|
| PubChem CID | 118538432 |
| Molecular Formula | C16H13BrN2O |
| Molecular Weight | 329.20 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 4-bromo-2-methyl-4,5-diphenylpyrazol-3-one |
| SMILES | CN1N=C(c2ccccc2)C(Br)(c2ccccc2)C1=O |
| InChI | InChI=1S/C16H13BrN2O/c1-19-15(20)16(17,13-10-6-3-7-11-13)14(18-19)12-8-4-2-5-9-12/h2-11H,1H3 |
| InChIKey | YGQZLDHMFHFRMS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.20 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|