C11H10BrClN2O — CID 118538462
4-bromo-4-(4-chlorophenyl)-2,5-dimethylpyrazol-3-one (PubChem CID 118538462) has the molecular formula C11H10BrClN2O and a molecular weight of 301.57 g/mol. Its IUPAC name is 4-bromo-4-(4-chlorophenyl)-2,5-dimethylpyrazol-3-one.
| Compound Name | 4-bromo-4-(4-chlorophenyl)-2,5-dimethylpyrazol-3-one |
|---|---|
| PubChem CID | 118538462 |
| Molecular Formula | C11H10BrClN2O |
| Molecular Weight | 301.57 g/mol |
| Exact Mass | 299.97 |
| IUPAC Name | 4-bromo-4-(4-chlorophenyl)-2,5-dimethylpyrazol-3-one |
| SMILES | CC1=NN(C)C(=O)C1(Br)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H10BrClN2O/c1-7-11(12,10(16)15(2)14-7)8-3-5-9(13)6-4-8/h3-6H,1-2H3 |
| InChIKey | RZUZVQDHKRAUBL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.57 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|