C12H9Br2ClN2O3 — CID 139775569
ethyl 4,4-dibromo-1-(4-chlorophenyl)-5-oxopyrazole-3-carboxylate (PubChem CID 139775569) has the molecular formula C12H9Br2ClN2O3 and a molecular weight of 424.48 g/mol. Its IUPAC name is ethyl 4,4-dibromo-1-(4-chlorophenyl)-5-oxopyrazole-3-carboxylate.
| Compound Name | ethyl 4,4-dibromo-1-(4-chlorophenyl)-5-oxopyrazole-3-carboxylate |
|---|---|
| PubChem CID | 139775569 |
| Molecular Formula | C12H9Br2ClN2O3 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 421.87 |
| IUPAC Name | ethyl 4,4-dibromo-1-(4-chlorophenyl)-5-oxopyrazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NN(c2ccc(Cl)cc2)C(=O)C1(Br)Br |
| InChI | InChI=1S/C12H9Br2ClN2O3/c1-2-20-10(18)9-12(13,14)11(19)17(16-9)8-5-3-7(15)4-6-8/h3-6H,2H2,1H3 |
| InChIKey | IQAWDEBELAXBMP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_5_A(7)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|