C7H8Br2N2O3 — CID 139775567
ethyl 4,4-dibromo-1-methyl-5-oxopyrazole-3-carboxylate (PubChem CID 139775567) has the molecular formula C7H8Br2N2O3 and a molecular weight of 327.96 g/mol. Its IUPAC name is ethyl 4,4-dibromo-1-methyl-5-oxopyrazole-3-carboxylate.
| Compound Name | ethyl 4,4-dibromo-1-methyl-5-oxopyrazole-3-carboxylate |
|---|---|
| PubChem CID | 139775567 |
| Molecular Formula | C7H8Br2N2O3 |
| Molecular Weight | 327.96 g/mol |
| Exact Mass | 325.89 |
| IUPAC Name | ethyl 4,4-dibromo-1-methyl-5-oxopyrazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NN(C)C(=O)C1(Br)Br |
| InChI | InChI=1S/C7H8Br2N2O3/c1-3-14-5(12)4-7(8,9)6(13)11(2)10-4/h3H2,1-2H3 |
| InChIKey | XXWMBWGADOCESC-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.96 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|