C7H9NO4 — CID 86309043
ethyl (4S)-4-methyl-5-oxo-4H-1,2-oxazole-3-carboxylate (PubChem CID 86309043) has the molecular formula C7H9NO4 and a molecular weight of 171.15 g/mol. Its IUPAC name is ethyl (4S)-4-methyl-5-oxo-4H-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl (4S)-4-methyl-5-oxo-4H-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 86309043 |
| Molecular Formula | C7H9NO4 |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | ethyl (4S)-4-methyl-5-oxo-4H-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NOC(=O)[C@H]1C |
| InChI | InChI=1S/C7H9NO4/c1-3-11-7(10)5-4(2)6(9)12-8-5/h4H,3H2,1-2H3/t4-/m0/s1 |
| InChIKey | IRFRNHVNUXOBBJ-BYPYZUCNSA-N |
| XLogP | 0.10 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|