C12H10BrF3N2O2 — CID 118538402
4-bromo-2,4-dimethyl-5-[2-(trifluoromethoxy)phenyl]pyrazol-3-one (PubChem CID 118538402) has the molecular formula C12H10BrF3N2O2 and a molecular weight of 351.12 g/mol. Its IUPAC name is 4-bromo-2,4-dimethyl-5-[2-(trifluoromethoxy)phenyl]pyrazol-3-one.
| Compound Name | 4-bromo-2,4-dimethyl-5-[2-(trifluoromethoxy)phenyl]pyrazol-3-one |
|---|---|
| PubChem CID | 118538402 |
| Molecular Formula | C12H10BrF3N2O2 |
| Molecular Weight | 351.12 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 4-bromo-2,4-dimethyl-5-[2-(trifluoromethoxy)phenyl]pyrazol-3-one |
| SMILES | CN1N=C(c2ccccc2OC(F)(F)F)C(C)(Br)C1=O |
| InChI | InChI=1S/C12H10BrF3N2O2/c1-11(13)9(17-18(2)10(11)19)7-5-3-4-6-8(7)20-12(14,15)16/h3-6H,1-2H3 |
| InChIKey | GCODUABQCLBMLS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.12 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|