C13H10F3NO2 — CID 133091499
2-methyl-3-[2-(trifluoromethoxy)phenyl]-1H-pyridin-4-one (PubChem CID 133091499) has the molecular formula C13H10F3NO2 and a molecular weight of 269.22 g/mol. Its IUPAC name is 2-methyl-3-[2-(trifluoromethoxy)phenyl]-1H-pyridin-4-one.
| Compound Name | 2-methyl-3-[2-(trifluoromethoxy)phenyl]-1H-pyridin-4-one |
|---|---|
| PubChem CID | 133091499 |
| Molecular Formula | C13H10F3NO2 |
| Molecular Weight | 269.22 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 2-methyl-3-[2-(trifluoromethoxy)phenyl]-1H-pyridin-4-one |
| SMILES | Cc1[nH]ccc(=O)c1-c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C13H10F3NO2/c1-8-12(10(18)6-7-17-8)9-4-2-3-5-11(9)19-13(14,15)16/h2-7H,1H3,(H,17,18) |
| InChIKey | MXWSGVASDTTZDC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.22 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |