C26H14F9NO3 — CID 134622953
3,4,5-tris[2-(trifluoromethoxy)phenyl]pyridine (PubChem CID 134622953) has the molecular formula C26H14F9NO3 and a molecular weight of 559.38 g/mol. Its IUPAC name is 3,4,5-tris[2-(trifluoromethoxy)phenyl]pyridine.
| Compound Name | 3,4,5-tris[2-(trifluoromethoxy)phenyl]pyridine |
|---|---|
| PubChem CID | 134622953 |
| Molecular Formula | C26H14F9NO3 |
| Molecular Weight | 559.38 g/mol |
| Exact Mass | 559.08 |
| IUPAC Name | 3,4,5-tris[2-(trifluoromethoxy)phenyl]pyridine |
| SMILES | FC(F)(F)Oc1ccccc1-c1cncc(-c2ccccc2OC(F)(F)F)c1-c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C26H14F9NO3/c27-24(28,29)37-20-10-4-1-7-15(20)18-13-36-14-19(16-8-2-5-11-21(16)38-25(30,31)32)23(18)17-9-3-6-12-22(17)39-26(33,34)35/h1-14H |
| InChIKey | YRVCNSOBYQHOSU-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.38 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |