C20H13F6NO3 — CID 134623318
4-methoxy-3,5-bis[2-(trifluoromethoxy)phenyl]pyridine (PubChem CID 134623318) has the molecular formula C20H13F6NO3 and a molecular weight of 429.32 g/mol. Its IUPAC name is 4-methoxy-3,5-bis[2-(trifluoromethoxy)phenyl]pyridine.
| Compound Name | 4-methoxy-3,5-bis[2-(trifluoromethoxy)phenyl]pyridine |
|---|---|
| PubChem CID | 134623318 |
| Molecular Formula | C20H13F6NO3 |
| Molecular Weight | 429.32 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | 4-methoxy-3,5-bis[2-(trifluoromethoxy)phenyl]pyridine |
| SMILES | COc1c(-c2ccccc2OC(F)(F)F)cncc1-c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C20H13F6NO3/c1-28-18-14(12-6-2-4-8-16(12)29-19(21,22)23)10-27-11-15(18)13-7-3-5-9-17(13)30-20(24,25)26/h2-11H,1H3 |
| InChIKey | NIVBQOZDEGORBS-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.32 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |