C13H7F6NO2 — CID 133091691
3-[2-(trifluoromethoxy)phenyl]-6-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 133091691) has the molecular formula C13H7F6NO2 and a molecular weight of 323.19 g/mol. Its IUPAC name is 3-[2-(trifluoromethoxy)phenyl]-6-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 3-[2-(trifluoromethoxy)phenyl]-6-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 133091691 |
| Molecular Formula | C13H7F6NO2 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 3-[2-(trifluoromethoxy)phenyl]-6-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | O=c1[nH]c(C(F)(F)F)ccc1-c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C13H7F6NO2/c14-12(15,16)10-6-5-8(11(21)20-10)7-3-1-2-4-9(7)22-13(17,18)19/h1-6H,(H,20,21) |
| InChIKey | GDENUNLTJURZJU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |