C8H5F6NO2 — CID 134666705
3-methyl-4-(trifluoromethoxy)-6-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 134666705) has the molecular formula C8H5F6NO2 and a molecular weight of 261.12 g/mol. Its IUPAC name is 3-methyl-4-(trifluoromethoxy)-6-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 3-methyl-4-(trifluoromethoxy)-6-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 134666705 |
| Molecular Formula | C8H5F6NO2 |
| Molecular Weight | 261.12 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | 3-methyl-4-(trifluoromethoxy)-6-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | Cc1c(OC(F)(F)F)cc(C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C8H5F6NO2/c1-3-4(17-8(12,13)14)2-5(7(9,10)11)15-6(3)16/h2H,1H3,(H,15,16) |
| InChIKey | DIBYVVIXDOEIOV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.12 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |