C8H8F3NO2 — CID 131168157
3,4-dimethyl-6-(trifluoromethoxy)-1H-pyridin-2-one (PubChem CID 131168157) has the molecular formula C8H8F3NO2 and a molecular weight of 207.15 g/mol. Its IUPAC name is 3,4-dimethyl-6-(trifluoromethoxy)-1H-pyridin-2-one.
| Compound Name | 3,4-dimethyl-6-(trifluoromethoxy)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 131168157 |
| Molecular Formula | C8H8F3NO2 |
| Molecular Weight | 207.15 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 3,4-dimethyl-6-(trifluoromethoxy)-1H-pyridin-2-one |
| SMILES | Cc1cc(OC(F)(F)F)[nH]c(=O)c1C |
| InChI | InChI=1S/C8H8F3NO2/c1-4-3-6(14-8(9,10)11)12-7(13)5(4)2/h3H,1-2H3,(H,12,13) |
| InChIKey | ANFIYDYPUZVFJT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.15 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |