C8H6F3NO3 — CID 130112222
2-methyl-4-oxo-6-(trifluoromethoxy)-1H-pyridine-3-carbaldehyde (PubChem CID 130112222) has the molecular formula C8H6F3NO3 and a molecular weight of 221.13 g/mol. Its IUPAC name is 2-methyl-4-oxo-6-(trifluoromethoxy)-1H-pyridine-3-carbaldehyde.
| Compound Name | 2-methyl-4-oxo-6-(trifluoromethoxy)-1H-pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 130112222 |
| Molecular Formula | C8H6F3NO3 |
| Molecular Weight | 221.13 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 2-methyl-4-oxo-6-(trifluoromethoxy)-1H-pyridine-3-carbaldehyde |
| SMILES | Cc1[nH]c(OC(F)(F)F)cc(=O)c1C=O |
| InChI | InChI=1S/C8H6F3NO3/c1-4-5(3-13)6(14)2-7(12-4)15-8(9,10)11/h2-3H,1H3,(H,12,14) |
| InChIKey | ADAKJOFSYOCDHQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.13 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|