C8H5F6NO3 — CID 134677601
3-methoxy-6-(trifluoromethoxy)-4-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 134677601) has the molecular formula C8H5F6NO3 and a molecular weight of 277.12 g/mol. Its IUPAC name is 3-methoxy-6-(trifluoromethoxy)-4-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 3-methoxy-6-(trifluoromethoxy)-4-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 134677601 |
| Molecular Formula | C8H5F6NO3 |
| Molecular Weight | 277.12 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 3-methoxy-6-(trifluoromethoxy)-4-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | COc1c(C(F)(F)F)cc(OC(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C8H5F6NO3/c1-17-5-3(7(9,10)11)2-4(15-6(5)16)18-8(12,13)14/h2H,1H3,(H,15,16) |
| InChIKey | SVFJVBXNYYBILN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.12 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |