C7H5F3INO2 — CID 130111059
3-iodo-4-methyl-6-(trifluoromethoxy)-1H-pyridin-2-one (PubChem CID 130111059) has the molecular formula C7H5F3INO2 and a molecular weight of 319.02 g/mol. Its IUPAC name is 3-iodo-4-methyl-6-(trifluoromethoxy)-1H-pyridin-2-one.
| Compound Name | 3-iodo-4-methyl-6-(trifluoromethoxy)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130111059 |
| Molecular Formula | C7H5F3INO2 |
| Molecular Weight | 319.02 g/mol |
| Exact Mass | 318.93 |
| IUPAC Name | 3-iodo-4-methyl-6-(trifluoromethoxy)-1H-pyridin-2-one |
| SMILES | Cc1cc(OC(F)(F)F)[nH]c(=O)c1I |
| InChI | InChI=1S/C7H5F3INO2/c1-3-2-4(14-7(8,9)10)12-6(13)5(3)11/h2H,1H3,(H,12,13) |
| InChIKey | AOTSJCRRLJVHBF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.02 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|