C9H7F6NO — CID 134640581
4-methoxy-3,5-bis(trifluoromethyl)aniline (PubChem CID 134640581) has the molecular formula C9H7F6NO and a molecular weight of 259.15 g/mol. Its IUPAC name is 4-methoxy-3,5-bis(trifluoromethyl)aniline.
| Compound Name | 4-methoxy-3,5-bis(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 134640581 |
| Molecular Formula | C9H7F6NO |
| Molecular Weight | 259.15 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 4-methoxy-3,5-bis(trifluoromethyl)aniline |
| SMILES | COc1c(C(F)(F)F)cc(N)cc1C(F)(F)F |
| InChI | InChI=1S/C9H7F6NO/c1-17-7-5(8(10,11)12)2-4(16)3-6(7)9(13,14)15/h2-3H,16H2,1H3 |
| InChIKey | AJHRSHCFMHEDGO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.15 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|