C8H7ClF3NO3 — CID 130111759
6-(chloromethyl)-3-methoxy-4-(trifluoromethoxy)-1H-pyridin-2-one (PubChem CID 130111759) has the molecular formula C8H7ClF3NO3 and a molecular weight of 257.59 g/mol. Its IUPAC name is 6-(chloromethyl)-3-methoxy-4-(trifluoromethoxy)-1H-pyridin-2-one.
| Compound Name | 6-(chloromethyl)-3-methoxy-4-(trifluoromethoxy)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130111759 |
| Molecular Formula | C8H7ClF3NO3 |
| Molecular Weight | 257.59 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | 6-(chloromethyl)-3-methoxy-4-(trifluoromethoxy)-1H-pyridin-2-one |
| SMILES | COc1c(OC(F)(F)F)cc(CCl)[nH]c1=O |
| InChI | InChI=1S/C8H7ClF3NO3/c1-15-6-5(16-8(10,11)12)2-4(3-9)13-7(6)14/h2H,3H2,1H3,(H,13,14) |
| InChIKey | RLAHEFPDUJJWMV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.59 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|