C10H10F3NO5 — CID 134677693
methyl 2-[2-methoxy-6-oxo-5-(trifluoromethoxy)-1H-pyridin-3-yl]acetate (PubChem CID 134677693) has the molecular formula C10H10F3NO5 and a molecular weight of 281.19 g/mol. Its IUPAC name is methyl 2-[2-methoxy-6-oxo-5-(trifluoromethoxy)-1H-pyridin-3-yl]acetate.
| Compound Name | methyl 2-[2-methoxy-6-oxo-5-(trifluoromethoxy)-1H-pyridin-3-yl]acetate |
|---|---|
| PubChem CID | 134677693 |
| Molecular Formula | C10H10F3NO5 |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | methyl 2-[2-methoxy-6-oxo-5-(trifluoromethoxy)-1H-pyridin-3-yl]acetate |
| SMILES | COC(=O)Cc1cc(OC(F)(F)F)c(=O)[nH]c1OC |
| InChI | InChI=1S/C10H10F3NO5/c1-17-7(15)4-5-3-6(19-10(11,12)13)8(16)14-9(5)18-2/h3H,4H2,1-2H3,(H,14,16) |
| InChIKey | GHPZFMOLJBRPNF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |