C7H7F3N2O3 — CID 131614035
5-(aminomethyl)-6-hydroxy-3-(trifluoromethoxy)-1H-pyridin-2-one (PubChem CID 131614035) has the molecular formula C7H7F3N2O3 and a molecular weight of 224.14 g/mol. Its IUPAC name is 5-(aminomethyl)-6-hydroxy-3-(trifluoromethoxy)-1H-pyridin-2-one.
| Compound Name | 5-(aminomethyl)-6-hydroxy-3-(trifluoromethoxy)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 131614035 |
| Molecular Formula | C7H7F3N2O3 |
| Molecular Weight | 224.14 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 5-(aminomethyl)-6-hydroxy-3-(trifluoromethoxy)-1H-pyridin-2-one |
| SMILES | NCc1cc(OC(F)(F)F)c(=O)[nH]c1O |
| InChI | InChI=1S/C7H7F3N2O3/c8-7(9,10)15-4-1-3(2-11)5(13)12-6(4)14/h1H,2,11H2,(H2,12,13,14) |
| InChIKey | CEEMEPMVESYBLN-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 88.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.14 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |