C7H6F3IN2O2 — CID 118806796
4-(aminomethyl)-6-iodo-5-(trifluoromethoxy)-1H-pyridin-2-one (PubChem CID 118806796) has the molecular formula C7H6F3IN2O2 and a molecular weight of 334.04 g/mol. Its IUPAC name is 4-(aminomethyl)-6-iodo-5-(trifluoromethoxy)-1H-pyridin-2-one.
| Compound Name | 4-(aminomethyl)-6-iodo-5-(trifluoromethoxy)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118806796 |
| Molecular Formula | C7H6F3IN2O2 |
| Molecular Weight | 334.04 g/mol |
| Exact Mass | 333.94 |
| IUPAC Name | 4-(aminomethyl)-6-iodo-5-(trifluoromethoxy)-1H-pyridin-2-one |
| SMILES | NCc1cc(=O)[nH]c(I)c1OC(F)(F)F |
| InChI | InChI=1S/C7H6F3IN2O2/c8-7(9,10)15-5-3(2-12)1-4(14)13-6(5)11/h1H,2,12H2,(H,13,14) |
| InChIKey | MXYZGCPWAVRDTH-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.04 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|