C7H7F2IN2O — CID 130082600
4-(aminomethyl)-6-(difluoromethyl)-5-iodo-1H-pyridin-2-one (PubChem CID 130082600) has the molecular formula C7H7F2IN2O and a molecular weight of 300.05 g/mol. Its IUPAC name is 4-(aminomethyl)-6-(difluoromethyl)-5-iodo-1H-pyridin-2-one.
| Compound Name | 4-(aminomethyl)-6-(difluoromethyl)-5-iodo-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130082600 |
| Molecular Formula | C7H7F2IN2O |
| Molecular Weight | 300.05 g/mol |
| Exact Mass | 299.96 |
| IUPAC Name | 4-(aminomethyl)-6-(difluoromethyl)-5-iodo-1H-pyridin-2-one |
| SMILES | NCc1cc(=O)[nH]c(C(F)F)c1I |
| InChI | InChI=1S/C7H7F2IN2O/c8-7(9)6-5(10)3(2-11)1-4(13)12-6/h1,7H,2,11H2,(H,12,13) |
| InChIKey | VWYGLFYUBDIXJS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.05 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|