C10H10F2INO3 — CID 133103526
ethyl 2-[2-(difluoromethyl)-3-iodo-6-oxo-1H-pyridin-4-yl]acetate (PubChem CID 133103526) has the molecular formula C10H10F2INO3 and a molecular weight of 357.09 g/mol. Its IUPAC name is ethyl 2-[2-(difluoromethyl)-3-iodo-6-oxo-1H-pyridin-4-yl]acetate.
| Compound Name | ethyl 2-[2-(difluoromethyl)-3-iodo-6-oxo-1H-pyridin-4-yl]acetate |
|---|---|
| PubChem CID | 133103526 |
| Molecular Formula | C10H10F2INO3 |
| Molecular Weight | 357.09 g/mol |
| Exact Mass | 356.97 |
| IUPAC Name | ethyl 2-[2-(difluoromethyl)-3-iodo-6-oxo-1H-pyridin-4-yl]acetate |
| SMILES | CCOC(=O)Cc1cc(=O)[nH]c(C(F)F)c1I |
| InChI | InChI=1S/C10H10F2INO3/c1-2-17-7(16)4-5-3-6(15)14-9(8(5)13)10(11)12/h3,10H,2,4H2,1H3,(H,14,15) |
| InChIKey | WAWWVJZCRMXHRV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.09 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|