C10H10F3NO3 — CID 133106232
ethyl 2-[2-(difluoromethyl)-5-fluoro-6-oxo-1H-pyridin-3-yl]acetate (PubChem CID 133106232) has the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. Its IUPAC name is ethyl 2-[2-(difluoromethyl)-5-fluoro-6-oxo-1H-pyridin-3-yl]acetate.
| Compound Name | ethyl 2-[2-(difluoromethyl)-5-fluoro-6-oxo-1H-pyridin-3-yl]acetate |
|---|---|
| PubChem CID | 133106232 |
| Molecular Formula | C10H10F3NO3 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | ethyl 2-[2-(difluoromethyl)-5-fluoro-6-oxo-1H-pyridin-3-yl]acetate |
| SMILES | CCOC(=O)Cc1cc(F)c(=O)[nH]c1C(F)F |
| InChI | InChI=1S/C10H10F3NO3/c1-2-17-7(15)4-5-3-6(11)10(16)14-8(5)9(12)13/h3,9H,2,4H2,1H3,(H,14,16) |
| InChIKey | IZGSNOIPRASOLW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |