C11H10F5NO4 — CID 134660644
ethyl 2-[6-(difluoromethyl)-4-oxo-5-(trifluoromethoxy)-1H-pyridin-2-yl]acetate (PubChem CID 134660644) has the molecular formula C11H10F5NO4 and a molecular weight of 315.19 g/mol. Its IUPAC name is ethyl 2-[6-(difluoromethyl)-4-oxo-5-(trifluoromethoxy)-1H-pyridin-2-yl]acetate.
| Compound Name | ethyl 2-[6-(difluoromethyl)-4-oxo-5-(trifluoromethoxy)-1H-pyridin-2-yl]acetate |
|---|---|
| PubChem CID | 134660644 |
| Molecular Formula | C11H10F5NO4 |
| Molecular Weight | 315.19 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | ethyl 2-[6-(difluoromethyl)-4-oxo-5-(trifluoromethoxy)-1H-pyridin-2-yl]acetate |
| SMILES | CCOC(=O)Cc1cc(=O)c(OC(F)(F)F)c(C(F)F)[nH]1 |
| InChI | InChI=1S/C11H10F5NO4/c1-2-20-7(19)4-5-3-6(18)9(21-11(14,15)16)8(17-5)10(12)13/h3,10H,2,4H2,1H3,(H,17,18) |
| InChIKey | KEGFYGCALJQJNP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.19 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |