C13H12FNO3 — CID 23992270
ethyl 2-(6-fluoro-4-oxo-1H-quinolin-2-yl)acetate (PubChem CID 23992270) has the molecular formula C13H12FNO3 and a molecular weight of 249.24 g/mol. Its IUPAC name is ethyl 2-(6-fluoro-4-oxo-1H-quinolin-2-yl)acetate.
| Compound Name | ethyl 2-(6-fluoro-4-oxo-1H-quinolin-2-yl)acetate |
|---|---|
| PubChem CID | 23992270 |
| Molecular Formula | C13H12FNO3 |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | ethyl 2-(6-fluoro-4-oxo-1H-quinolin-2-yl)acetate |
| SMILES | CCOC(=O)Cc1cc(=O)c2cc(F)ccc2[nH]1 |
| InChI | InChI=1S/C13H12FNO3/c1-2-18-13(17)7-9-6-12(16)10-5-8(14)3-4-11(10)15-9/h3-6H,2,7H2,1H3,(H,15,16) |
| InChIKey | ARSVHQUSKBINKZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |