C13H12FNO4 — CID 138980470
2-O-ethyl 3-O-methyl 5-fluoro-1H-indole-2,3-dicarboxylate (PubChem CID 138980470) has the molecular formula C13H12FNO4 and a molecular weight of 265.24 g/mol. Its IUPAC name is 2-O-ethyl 3-O-methyl 5-fluoro-1H-indole-2,3-dicarboxylate.
| Compound Name | 2-O-ethyl 3-O-methyl 5-fluoro-1H-indole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 138980470 |
| Molecular Formula | C13H12FNO4 |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 2-O-ethyl 3-O-methyl 5-fluoro-1H-indole-2,3-dicarboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccc(F)cc2c1C(=O)OC |
| InChI | InChI=1S/C13H12FNO4/c1-3-19-13(17)11-10(12(16)18-2)8-6-7(14)4-5-9(8)15-11/h4-6,15H,3H2,1-2H3 |
| InChIKey | OIGJDISCMXYUDS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |