C16H17FN4O6 — CID 177265540
ethyl 3-[bis(methoxycarbonylamino)methylideneamino]-5-fluoro-1H-indole-2-carboxylate (PubChem CID 177265540) has the molecular formula C16H17FN4O6 and a molecular weight of 380.33 g/mol. Its IUPAC name is ethyl 3-[bis(methoxycarbonylamino)methylideneamino]-5-fluoro-1H-indole-2-carboxylate.
| Compound Name | ethyl 3-[bis(methoxycarbonylamino)methylideneamino]-5-fluoro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 177265540 |
| Molecular Formula | C16H17FN4O6 |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | ethyl 3-[bis(methoxycarbonylamino)methylideneamino]-5-fluoro-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccc(F)cc2c1N=C(NC(=O)OC)NC(=O)OC |
| InChI | InChI=1S/C16H17FN4O6/c1-4-27-13(22)12-11(9-7-8(17)5-6-10(9)18-12)19-14(20-15(23)25-2)21-16(24)26-3/h5-7,18H,4H2,1-3H3,(H2,19,20,21,23,24) |
| InChIKey | XWKDIIYLSNFJFQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|