C10H9F3N2O6 — CID 134665425
ethyl 2-[5-nitro-4-oxo-6-(trifluoromethoxy)-1H-pyridin-2-yl]acetate (PubChem CID 134665425) has the molecular formula C10H9F3N2O6 and a molecular weight of 310.18 g/mol. Its IUPAC name is ethyl 2-[5-nitro-4-oxo-6-(trifluoromethoxy)-1H-pyridin-2-yl]acetate.
| Compound Name | ethyl 2-[5-nitro-4-oxo-6-(trifluoromethoxy)-1H-pyridin-2-yl]acetate |
|---|---|
| PubChem CID | 134665425 |
| Molecular Formula | C10H9F3N2O6 |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | ethyl 2-[5-nitro-4-oxo-6-(trifluoromethoxy)-1H-pyridin-2-yl]acetate |
| SMILES | CCOC(=O)Cc1cc(=O)c([N+](=O)[O-])c(OC(F)(F)F)[nH]1 |
| InChI | InChI=1S/C10H9F3N2O6/c1-2-20-7(17)4-5-3-6(16)8(15(18)19)9(14-5)21-10(11,12)13/h3H,2,4H2,1H3,(H,14,16) |
| InChIKey | TVWSITDSWCCRJM-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|