C9H7F3N2O6 — CID 134660258
ethyl 3-nitro-4-oxo-6-(trifluoromethoxy)-1H-pyridine-2-carboxylate (PubChem CID 134660258) has the molecular formula C9H7F3N2O6 and a molecular weight of 296.16 g/mol. Its IUPAC name is ethyl 3-nitro-4-oxo-6-(trifluoromethoxy)-1H-pyridine-2-carboxylate.
| Compound Name | ethyl 3-nitro-4-oxo-6-(trifluoromethoxy)-1H-pyridine-2-carboxylate |
|---|---|
| PubChem CID | 134660258 |
| Molecular Formula | C9H7F3N2O6 |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | ethyl 3-nitro-4-oxo-6-(trifluoromethoxy)-1H-pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(OC(F)(F)F)cc(=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H7F3N2O6/c1-2-19-8(16)6-7(14(17)18)4(15)3-5(13-6)20-9(10,11)12/h3H,2H2,1H3,(H,13,15) |
| InChIKey | VAJGKPYXCZGNTH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|