C9H8F2N2O5 — CID 133103099
ethyl 6-(difluoromethyl)-5-nitro-4-oxo-1H-pyridine-2-carboxylate (PubChem CID 133103099) has the molecular formula C9H8F2N2O5 and a molecular weight of 262.17 g/mol. Its IUPAC name is ethyl 6-(difluoromethyl)-5-nitro-4-oxo-1H-pyridine-2-carboxylate.
| Compound Name | ethyl 6-(difluoromethyl)-5-nitro-4-oxo-1H-pyridine-2-carboxylate |
|---|---|
| PubChem CID | 133103099 |
| Molecular Formula | C9H8F2N2O5 |
| Molecular Weight | 262.17 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | ethyl 6-(difluoromethyl)-5-nitro-4-oxo-1H-pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cc(=O)c([N+](=O)[O-])c(C(F)F)[nH]1 |
| InChI | InChI=1S/C9H8F2N2O5/c1-2-18-9(15)4-3-5(14)7(13(16)17)6(12-4)8(10)11/h3,8H,2H2,1H3,(H,12,14) |
| InChIKey | GNARCXOFQYYWRW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.17 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|