C11H13F3N2O4 — CID 134678407
ethyl 2-[2-(aminomethyl)-4-oxo-6-(trifluoromethoxy)-1H-pyridin-3-yl]acetate (PubChem CID 134678407) has the molecular formula C11H13F3N2O4 and a molecular weight of 294.23 g/mol. Its IUPAC name is ethyl 2-[2-(aminomethyl)-4-oxo-6-(trifluoromethoxy)-1H-pyridin-3-yl]acetate.
| Compound Name | ethyl 2-[2-(aminomethyl)-4-oxo-6-(trifluoromethoxy)-1H-pyridin-3-yl]acetate |
|---|---|
| PubChem CID | 134678407 |
| Molecular Formula | C11H13F3N2O4 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | ethyl 2-[2-(aminomethyl)-4-oxo-6-(trifluoromethoxy)-1H-pyridin-3-yl]acetate |
| SMILES | CCOC(=O)Cc1c(CN)[nH]c(OC(F)(F)F)cc1=O |
| InChI | InChI=1S/C11H13F3N2O4/c1-2-19-10(18)3-6-7(5-15)16-9(4-8(6)17)20-11(12,13)14/h4H,2-3,5,15H2,1H3,(H,16,17) |
| InChIKey | XJGNXYSCWPBDBJ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 94.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |