C9H10F2N2O3 — CID 133093512
methyl 2-[5-amino-2-(difluoromethyl)-6-oxo-1H-pyridin-3-yl]acetate (PubChem CID 133093512) has the molecular formula C9H10F2N2O3 and a molecular weight of 232.19 g/mol. Its IUPAC name is methyl 2-[5-amino-2-(difluoromethyl)-6-oxo-1H-pyridin-3-yl]acetate.
| Compound Name | methyl 2-[5-amino-2-(difluoromethyl)-6-oxo-1H-pyridin-3-yl]acetate |
|---|---|
| PubChem CID | 133093512 |
| Molecular Formula | C9H10F2N2O3 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | methyl 2-[5-amino-2-(difluoromethyl)-6-oxo-1H-pyridin-3-yl]acetate |
| SMILES | COC(=O)Cc1cc(N)c(=O)[nH]c1C(F)F |
| InChI | InChI=1S/C9H10F2N2O3/c1-16-6(14)3-4-2-5(12)9(15)13-7(4)8(10)11/h2,8H,3,12H2,1H3,(H,13,15) |
| InChIKey | RVEUSSJNUYWOMQ-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |