C9H8BrF2NO3 — CID 134671753
methyl 2-[2-bromo-3-(difluoromethyl)-6-oxo-1H-pyridin-4-yl]acetate (PubChem CID 134671753) has the molecular formula C9H8BrF2NO3 and a molecular weight of 296.07 g/mol. Its IUPAC name is methyl 2-[2-bromo-3-(difluoromethyl)-6-oxo-1H-pyridin-4-yl]acetate.
| Compound Name | methyl 2-[2-bromo-3-(difluoromethyl)-6-oxo-1H-pyridin-4-yl]acetate |
|---|---|
| PubChem CID | 134671753 |
| Molecular Formula | C9H8BrF2NO3 |
| Molecular Weight | 296.07 g/mol |
| Exact Mass | 294.97 |
| IUPAC Name | methyl 2-[2-bromo-3-(difluoromethyl)-6-oxo-1H-pyridin-4-yl]acetate |
| SMILES | COC(=O)Cc1cc(=O)[nH]c(Br)c1C(F)F |
| InChI | InChI=1S/C9H8BrF2NO3/c1-16-6(15)3-4-2-5(14)13-8(10)7(4)9(11)12/h2,9H,3H2,1H3,(H,13,14) |
| InChIKey | BONBIWLEJYTHCC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.07 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|