C8H10F2N2O2 — CID 118808520
6-(aminomethyl)-5-(difluoromethyl)-4-(hydroxymethyl)-1H-pyridin-2-one (PubChem CID 118808520) has the molecular formula C8H10F2N2O2 and a molecular weight of 204.18 g/mol. Its IUPAC name is 6-(aminomethyl)-5-(difluoromethyl)-4-(hydroxymethyl)-1H-pyridin-2-one.
| Compound Name | 6-(aminomethyl)-5-(difluoromethyl)-4-(hydroxymethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118808520 |
| Molecular Formula | C8H10F2N2O2 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 6-(aminomethyl)-5-(difluoromethyl)-4-(hydroxymethyl)-1H-pyridin-2-one |
| SMILES | NCc1[nH]c(=O)cc(CO)c1C(F)F |
| InChI | InChI=1S/C8H10F2N2O2/c9-8(10)7-4(3-13)1-6(14)12-5(7)2-11/h1,8,13H,2-3,11H2,(H,12,14) |
| InChIKey | GQWPQKKTQXMVJE-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |