C8H7F5N2O — CID 118853573
6-(aminomethyl)-5-(difluoromethyl)-4-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 118853573) has the molecular formula C8H7F5N2O and a molecular weight of 242.15 g/mol. Its IUPAC name is 6-(aminomethyl)-5-(difluoromethyl)-4-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 6-(aminomethyl)-5-(difluoromethyl)-4-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118853573 |
| Molecular Formula | C8H7F5N2O |
| Molecular Weight | 242.15 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 6-(aminomethyl)-5-(difluoromethyl)-4-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | NCc1[nH]c(=O)cc(C(F)(F)F)c1C(F)F |
| InChI | InChI=1S/C8H7F5N2O/c9-7(10)6-3(8(11,12)13)1-5(16)15-4(6)2-14/h1,7H,2,14H2,(H,15,16) |
| InChIKey | GAQHZPLYIOUDSI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.15 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |