C7H7BrF2N2O — CID 130104697
4-amino-6-(bromomethyl)-5-(difluoromethyl)-1H-pyridin-2-one (PubChem CID 130104697) has the molecular formula C7H7BrF2N2O and a molecular weight of 253.05 g/mol. Its IUPAC name is 4-amino-6-(bromomethyl)-5-(difluoromethyl)-1H-pyridin-2-one.
| Compound Name | 4-amino-6-(bromomethyl)-5-(difluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130104697 |
| Molecular Formula | C7H7BrF2N2O |
| Molecular Weight | 253.05 g/mol |
| Exact Mass | 251.97 |
| IUPAC Name | 4-amino-6-(bromomethyl)-5-(difluoromethyl)-1H-pyridin-2-one |
| SMILES | Nc1cc(=O)[nH]c(CBr)c1C(F)F |
| InChI | InChI=1S/C7H7BrF2N2O/c8-2-4-6(7(9)10)3(11)1-5(13)12-4/h1,7H,2H2,(H3,11,12,13) |
| InChIKey | PRTYNEMTSQXPNO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.05 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|