C7H5BrClF2NO — CID 130110266
4-bromo-6-(chloromethyl)-5-(difluoromethyl)-1H-pyridin-2-one (PubChem CID 130110266) has the molecular formula C7H5BrClF2NO and a molecular weight of 272.48 g/mol. Its IUPAC name is 4-bromo-6-(chloromethyl)-5-(difluoromethyl)-1H-pyridin-2-one.
| Compound Name | 4-bromo-6-(chloromethyl)-5-(difluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130110266 |
| Molecular Formula | C7H5BrClF2NO |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 270.92 |
| IUPAC Name | 4-bromo-6-(chloromethyl)-5-(difluoromethyl)-1H-pyridin-2-one |
| SMILES | O=c1cc(Br)c(C(F)F)c(CCl)[nH]1 |
| InChI | InChI=1S/C7H5BrClF2NO/c8-3-1-5(13)12-4(2-9)6(3)7(10)11/h1,7H,2H2,(H,12,13) |
| InChIKey | SRFDQNTULOXLIK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|