C8H8ClF2NO2 — CID 118849612
6-(chloromethyl)-4-(difluoromethyl)-5-(hydroxymethyl)-1H-pyridin-2-one (PubChem CID 118849612) has the molecular formula C8H8ClF2NO2 and a molecular weight of 223.61 g/mol. Its IUPAC name is 6-(chloromethyl)-4-(difluoromethyl)-5-(hydroxymethyl)-1H-pyridin-2-one.
| Compound Name | 6-(chloromethyl)-4-(difluoromethyl)-5-(hydroxymethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118849612 |
| Molecular Formula | C8H8ClF2NO2 |
| Molecular Weight | 223.61 g/mol |
| Exact Mass | 223.02 |
| IUPAC Name | 6-(chloromethyl)-4-(difluoromethyl)-5-(hydroxymethyl)-1H-pyridin-2-one |
| SMILES | O=c1cc(C(F)F)c(CO)c(CCl)[nH]1 |
| InChI | InChI=1S/C8H8ClF2NO2/c9-2-6-5(3-13)4(8(10)11)1-7(14)12-6/h1,8,13H,2-3H2,(H,12,14) |
| InChIKey | DSCLAATVUOBGGK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.61 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|