C9H8ClF2NO3 — CID 118821536
2-[6-(chloromethyl)-5-(difluoromethyl)-2-oxo-1H-pyridin-3-yl]acetic acid (PubChem CID 118821536) has the molecular formula C9H8ClF2NO3 and a molecular weight of 251.62 g/mol. Its IUPAC name is 2-[6-(chloromethyl)-5-(difluoromethyl)-2-oxo-1H-pyridin-3-yl]acetic acid.
| Compound Name | 2-[6-(chloromethyl)-5-(difluoromethyl)-2-oxo-1H-pyridin-3-yl]acetic acid |
|---|---|
| PubChem CID | 118821536 |
| Molecular Formula | C9H8ClF2NO3 |
| Molecular Weight | 251.62 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | 2-[6-(chloromethyl)-5-(difluoromethyl)-2-oxo-1H-pyridin-3-yl]acetic acid |
| SMILES | O=C(O)Cc1cc(C(F)F)c(CCl)[nH]c1=O |
| InChI | InChI=1S/C9H8ClF2NO3/c10-3-6-5(8(11)12)1-4(2-7(14)15)9(16)13-6/h1,8H,2-3H2,(H,13,16)(H,14,15) |
| InChIKey | DZYSZYRYQVVTKP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.62 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|