C7H6BrF2NO2 — CID 130100163
5-(bromomethyl)-4-(difluoromethyl)-6-hydroxy-1H-pyridin-2-one (PubChem CID 130100163) has the molecular formula C7H6BrF2NO2 and a molecular weight of 254.03 g/mol. Its IUPAC name is 5-(bromomethyl)-4-(difluoromethyl)-6-hydroxy-1H-pyridin-2-one.
| Compound Name | 5-(bromomethyl)-4-(difluoromethyl)-6-hydroxy-1H-pyridin-2-one |
|---|---|
| PubChem CID | 130100163 |
| Molecular Formula | C7H6BrF2NO2 |
| Molecular Weight | 254.03 g/mol |
| Exact Mass | 252.95 |
| IUPAC Name | 5-(bromomethyl)-4-(difluoromethyl)-6-hydroxy-1H-pyridin-2-one |
| SMILES | O=c1cc(C(F)F)c(CBr)c(O)[nH]1 |
| InChI | InChI=1S/C7H6BrF2NO2/c8-2-4-3(6(9)10)1-5(12)11-7(4)13/h1,6H,2H2,(H2,11,12,13) |
| InChIKey | UXZUCSNWZQOHBU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.03 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|