C10H9ClF3NO4 — CID 134679042
methyl 2-[6-(chloromethyl)-4-oxo-5-(trifluoromethoxy)-1H-pyridin-2-yl]acetate (PubChem CID 134679042) has the molecular formula C10H9ClF3NO4 and a molecular weight of 299.63 g/mol. Its IUPAC name is methyl 2-[6-(chloromethyl)-4-oxo-5-(trifluoromethoxy)-1H-pyridin-2-yl]acetate.
| Compound Name | methyl 2-[6-(chloromethyl)-4-oxo-5-(trifluoromethoxy)-1H-pyridin-2-yl]acetate |
|---|---|
| PubChem CID | 134679042 |
| Molecular Formula | C10H9ClF3NO4 |
| Molecular Weight | 299.63 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | methyl 2-[6-(chloromethyl)-4-oxo-5-(trifluoromethoxy)-1H-pyridin-2-yl]acetate |
| SMILES | COC(=O)Cc1cc(=O)c(OC(F)(F)F)c(CCl)[nH]1 |
| InChI | InChI=1S/C10H9ClF3NO4/c1-18-8(17)3-5-2-7(16)9(6(4-11)15-5)19-10(12,13)14/h2H,3-4H2,1H3,(H,15,16) |
| InChIKey | YUKUYEYWMRWYPX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.63 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|