C10H9F4NO4 — CID 134662054
methyl 2-[6-(fluoromethyl)-4-oxo-3-(trifluoromethoxy)-1H-pyridin-2-yl]acetate (PubChem CID 134662054) has the molecular formula C10H9F4NO4 and a molecular weight of 283.18 g/mol. Its IUPAC name is methyl 2-[6-(fluoromethyl)-4-oxo-3-(trifluoromethoxy)-1H-pyridin-2-yl]acetate.
| Compound Name | methyl 2-[6-(fluoromethyl)-4-oxo-3-(trifluoromethoxy)-1H-pyridin-2-yl]acetate |
|---|---|
| PubChem CID | 134662054 |
| Molecular Formula | C10H9F4NO4 |
| Molecular Weight | 283.18 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | methyl 2-[6-(fluoromethyl)-4-oxo-3-(trifluoromethoxy)-1H-pyridin-2-yl]acetate |
| SMILES | COC(=O)Cc1[nH]c(CF)cc(=O)c1OC(F)(F)F |
| InChI | InChI=1S/C10H9F4NO4/c1-18-8(17)3-6-9(19-10(12,13)14)7(16)2-5(4-11)15-6/h2H,3-4H2,1H3,(H,15,16) |
| InChIKey | JGIDINUTUYTKFN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.18 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |