C8H4F5NO4 — CID 134666248
3-(difluoromethyl)-4-oxo-6-(trifluoromethoxy)-1H-pyridine-2-carboxylic acid (PubChem CID 134666248) has the molecular formula C8H4F5NO4 and a molecular weight of 273.11 g/mol. Its IUPAC name is 3-(difluoromethyl)-4-oxo-6-(trifluoromethoxy)-1H-pyridine-2-carboxylic acid.
| Compound Name | 3-(difluoromethyl)-4-oxo-6-(trifluoromethoxy)-1H-pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 134666248 |
| Molecular Formula | C8H4F5NO4 |
| Molecular Weight | 273.11 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | 3-(difluoromethyl)-4-oxo-6-(trifluoromethoxy)-1H-pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1[nH]c(OC(F)(F)F)cc(=O)c1C(F)F |
| InChI | InChI=1S/C8H4F5NO4/c9-6(10)4-2(15)1-3(18-8(11,12)13)14-5(4)7(16)17/h1,6H,(H,14,15)(H,16,17) |
| InChIKey | BUATVLYQGGZGDJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.11 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |