C9H9F2NO4 — CID 133103454
2-[3-(difluoromethyl)-6-methoxy-4-oxo-1H-pyridin-2-yl]acetic acid (PubChem CID 133103454) has the molecular formula C9H9F2NO4 and a molecular weight of 233.17 g/mol. Its IUPAC name is 2-[3-(difluoromethyl)-6-methoxy-4-oxo-1H-pyridin-2-yl]acetic acid.
| Compound Name | 2-[3-(difluoromethyl)-6-methoxy-4-oxo-1H-pyridin-2-yl]acetic acid |
|---|---|
| PubChem CID | 133103454 |
| Molecular Formula | C9H9F2NO4 |
| Molecular Weight | 233.17 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 2-[3-(difluoromethyl)-6-methoxy-4-oxo-1H-pyridin-2-yl]acetic acid |
| SMILES | COc1cc(=O)c(C(F)F)c(CC(=O)O)[nH]1 |
| InChI | InChI=1S/C9H9F2NO4/c1-16-6-3-5(13)8(9(10)11)4(12-6)2-7(14)15/h3,9H,2H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | OKJUFUVEKZCPOK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.17 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |