C7H6F3NO3 — CID 131214048
5-hydroxy-6-methyl-4-(trifluoromethoxy)-1H-pyridin-2-one (PubChem CID 131214048) has the molecular formula C7H6F3NO3 and a molecular weight of 209.12 g/mol. Its IUPAC name is 5-hydroxy-6-methyl-4-(trifluoromethoxy)-1H-pyridin-2-one.
| Compound Name | 5-hydroxy-6-methyl-4-(trifluoromethoxy)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 131214048 |
| Molecular Formula | C7H6F3NO3 |
| Molecular Weight | 209.12 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 5-hydroxy-6-methyl-4-(trifluoromethoxy)-1H-pyridin-2-one |
| SMILES | Cc1[nH]c(=O)cc(OC(F)(F)F)c1O |
| InChI | InChI=1S/C7H6F3NO3/c1-3-6(13)4(2-5(12)11-3)14-7(8,9)10/h2,13H,1H3,(H,11,12) |
| InChIKey | ZLRNEDSVNCFJEJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.12 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |